| CAS ID | 2051-98-1 |
|---|---|
| IUPAC Name | 5-bromo-1,2-dihydroacenaphthylene |
| Molecular Formula | C12H9Br |
| Molecular Weight | |
| SMILES | BrC1=C2C=CC=C3CCC(C=C1)=C32 |
| CAS ID | 2051-98-1 |
|---|---|
| IUPAC Name | 5-bromo-1,2-dihydroacenaphthylene |
| Molecular Formula | C12H9Br |
| Molecular Weight | |
| SMILES | BrC1=C2C=CC=C3CCC(C=C1)=C32 |
| 74923 |
Synonyms: 5-bromoacenaphthene, acenaphthene, 5-bromo, acenaphthylene, 5-bromo-1,2-dihydro, 5-bromoacenaphtene, 5-bromo acenaphthene, akos 51, maybridge1_006415, acmc-1ccr7
| Melting Point | 55°C |
| Quantity | 5g |
| Boiling Point | 335°C |
| Color | Yellow |
| Formula Weight | 233.11 |
| Physical Form | Crystal-Powder at 20°C |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
