| CAS ID | 22179-86-8 |
|---|---|
| IUPAC Name | (2E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoic acid |
| Molecular Formula | C8H7F3N2O |
| Molecular Weight | |
| SMILES | OC(=O)C=CC1=CC=CC=C1C(F)(F)F. |
| CAS ID | 22179-86-8 |
|---|---|
| IUPAC Name | (2E)-3-[2-(trifluoromethyl)phenyl]prop-2-enoic acid |
| Molecular Formula | C8H7F3N2O |
| Molecular Weight | |
| SMILES | OC(=O)C=CC1=CC=CC=C1C(F)(F)F. |
| 719625 |
Synonym: 2-trifluoromethyl cinnamic acid, o-trifluoromethyl cinnamic acid, 2-trifluoromethylcinnamic acid, e-3-2-trifluoromethyl phenyl acrylic acid, 2e-3-2-trifluoromethyl phenyl prop-2-enoic acid, 3-2-trifluoromethyl phenyl acrylic acid, 2e-3-2-trifluoroformyl phenyl acrylic acid, e-2-trifluoromethyl cinnamic acid, 3-2-trifluoromethyl-phenyl-acrylic acid
| Melting Point | 204°C |
| Color | White-Yellow |
| Formula Weight | 216.16 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-(Trifluoromethyl)cinnamic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
