| CAS ID | 92841-65-1 |
|---|---|
| IUPAC Name | (4R, 5-Dimethyl-4-phenylimidazolidin-2-one, 5S)-(-)-1 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | |
| SMILES | C[C@H]1[C@H](NC(=O)N1C)C2=CC=CC=C2 |
| CAS ID | 92841-65-1 |
|---|---|
| IUPAC Name | (4R, 5-Dimethyl-4-phenylimidazolidin-2-one, 5S)-(-)-1 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | |
| SMILES | C[C@H]1[C@H](NC(=O)N1C)C2=CC=CC=C2 |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
