| CAS ID | 19362-77-7 |
|---|---|
| IUPAC Name | 4-[(4-sulfanylphenyl)sulfanyl]benzene-1-thiol |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | SC1=CC=C(SC2=CC=C(S)C=C2)C=C1 |
| CAS ID | 19362-77-7 |
|---|---|
| IUPAC Name | 4-[(4-sulfanylphenyl)sulfanyl]benzene-1-thiol |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | SC1=CC=C(SC2=CC=C(S)C=C2)C=C1 |
| 619483 |
Synonym: Bis(4-mercaptophenyl) Sulfide
| Color | Undesignated |
| Boiling Point | 148°C |
| Melting Point | 113°C |
| Formula Weight | 250.39 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 4,4′-Thiobisbenzenethiol |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
