| CAS ID | 13680-35-8 |
|---|---|
| IUPAC Name | 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline |
| Molecular Formula | C21H30N2 |
| Molecular Weight | |
| SMILES | CCC1=CC(=CC(=C1N)CC)CC2=CC(=C(C(=C2)CC)N)CC |
| CAS ID | 13680-35-8 |
|---|---|
| IUPAC Name | 4-[(4-amino-3,5-diethylphenyl)methyl]-2,6-diethylaniline |
| Molecular Formula | C21H30N2 |
| Molecular Weight | |
| SMILES | CCC1=CC(=CC(=C1N)CC)CC2=CC(=C(C(=C2)CC)N)CC |
| 83656 |
Synonym: 4,4′-methylenebis 2,6-diethylaniline, benzenamine, 4,4′-methylenebis 2,6-diethyl, bis 4-amino-3,5-diethylphenyl methane, 4,4′-methylene-bis-2,6-diethylaniline, 4-4-amino-3,5-diethylphenyl methyl-2,6-diethylaniline, 4,4/’-methylenebis 2,6-diethylaniline, 4-4-amino-3,5-diethylphenyl methyl-2,6-diethylphenylamine, lonzacure r m-dea, acmc-1bxlo
| Melting Point | 90°C |
| Color | Undesignated |
| Boiling Point | 205°C |
| Formula Weight | 310.49 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 4,4′-Methylenebis(2,6-diethylaniline) |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
