| CAS ID | 613-33-2 |
|---|---|
| IUPAC Name | 1-methyl-4-(4-methylphenyl)benzene |
| Molecular Formula | C14H14 |
| Molecular Weight | |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)C |
| CAS ID | 613-33-2 |
|---|---|
| IUPAC Name | 1-methyl-4-(4-methylphenyl)benzene |
| Molecular Formula | C14H14 |
| Molecular Weight | |
| SMILES | CC1=CC=C(C=C1)C2=CC=C(C=C2)C |
| 11941 |
Synonym: 4,4′-dimethylbiphenyl, 4,4′-bitolyl, 4,4′-dimethyldiphenyl, bi-p-tolyl, di-p-tolyl, p,p’-bitolyl, 4,4′-dimethyl-1,1′-biphenyl, 4,4′-ditolyl, 1,1′-biphenyl, 4,4′-dimethyl, 4,4′-dimethyl-biphenyl
| Color | White-Yellow |
| Melting Point | 122°C |
| Formula Weight | 182.27 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 4,4′-Dimethylbiphenyl |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
