| CAS ID | 3236-71-3 |
|---|---|
| IUPAC Name | 4-[9-(4-hydroxyphenyl)-9H-fluoren-9-yl]phenol |
| Molecular Formula | C25H18O2 |
| Molecular Weight | |
| SMILES | OC1=CC=C(C=C1)C1(C2=CC=CC=C2C2=CC=CC=C12)C1=CC=C(O)C=C1 |
| CAS ID | 3236-71-3 |
|---|---|
| IUPAC Name | 4-[9-(4-hydroxyphenyl)-9H-fluoren-9-yl]phenol |
| Molecular Formula | C25H18O2 |
| Molecular Weight | |
| SMILES | OC1=CC=C(C=C1)C1(C2=CC=CC=C2C2=CC=CC=C12)C1=CC=C(O)C=C1 |
| 76716 |
Synonym: 4,4′-(9-Fluorenylidene)diphenol
| Color | White |
| Melting Point | 226°C |
| UN Number | 3077 |
| Formula Weight | 350.42 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 9,9-Bis(4-hydroxyphenyl)fluorene (purified by sublimation) |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
