| CAS ID | 70010-48-9 |
|---|---|
| IUPAC Name | 4-thiophen-2-ylaniline |
| Molecular Formula | C10H9NS |
| Molecular Weight | |
| SMILES | C1=CSC(=C1)C2=CC=C(C=C2)N |
| CAS ID | 70010-48-9 |
|---|---|
| IUPAC Name | 4-thiophen-2-ylaniline |
| Molecular Formula | C10H9NS |
| Molecular Weight | |
| SMILES | C1=CSC(=C1)C2=CC=C(C=C2)N |
| 1072474 |
Synonym: 4-2-thienyl aniline, 4-thiophen-2-yl aniline, 4-thiophen-2-ylphenylamine, benzenamine, 4-2-thienyl, 4-2-thienyl phenylamine, 4-2-thienyl-anilin, 4-thiophen-2-yl-anilin, benzenamine,4-2-thienyl, 1-2-thienyl-4-aminobenzene
| Melting Point | 74°C to 78°C |
| Formula Weight | 175.25 |
| Chemical Name or Material | 4-(2-Thienyl)aniline |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
