| CAS ID | 4097-49-8 |
|---|---|
| IUPAC Name | 4-tert-butyl-2,6-dinitrophenol |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | |
| SMILES | CC(C)(C)C1=CC(=C(O)C(=C1)[N+]([O-])=O)[N+]([O-])=O |
| CAS ID | 4097-49-8 |
|---|---|
| IUPAC Name | 4-tert-butyl-2,6-dinitrophenol |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | |
| SMILES | CC(C)(C)C1=CC(=C(O)C(=C1)[N+]([O-])=O)[N+]([O-])=O |
| 20042 |
Synonym : 4-tert-butyl-2,6-dinitrophenol, 2,6-dinitro-4-tert-butylphenol, unii-m5s512rl03, phenol, 4-1,1-dimethylethyl-2,6-dinitro, 2,6-dinitro-p-tert-butyl phenol, phenol, 4-tert-butyl-2,6-dinitro, acmc-1am7s, 2,6-dinitro-4-t-butylphenol, 4-t-butyl-2,6-dinitrophenol
| Color | Yellow |
| Melting Point | 94°C |
| UN Number | 2811 |
| Formula Weight | 240.22 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 4-tert-Butyl-2,6-dinitrophenol |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
