| CAS ID | 99-99-0 |
|---|---|
| IUPAC Name | 1-methyl-4-nitrobenzene |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | |
| SMILES | CC1=CC=C(C=C1)[N+]([O-])=O |
| CAS ID | 99-99-0 |
|---|---|
| IUPAC Name | 1-methyl-4-nitrobenzene |
| Molecular Formula | C7H7NO2 |
| Molecular Weight | |
| SMILES | CC1=CC=C(C=C1)[N+]([O-])=O |
| 7473 |
Synonym : 4-nitrotoluene, p-nitrotoluene, 4-methylnitrobenzene, 4-nitrotoluol, benzene, 1-methyl-4-nitro, toluene, p-nitro, p-methylnitrobenzene, para-nitrotoluol, nitrotoluenos, nitrotoluene, p
| Boiling Point | 238°C |
| Color | Undesignated |
| Melting Point | 53°C |
| UN Number | 3446 |
| Formula Weight | 137.14 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 4-Nitrotoluene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
