| CAS ID | 777-52-6 |
|---|---|
| IUPAC Name | 4-nitrophenyl phosphorodichloridate |
| Molecular Formula | C6H4Cl2NO4P |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(Cl)Cl |
| CAS ID | 777-52-6 |
|---|---|
| IUPAC Name | 4-nitrophenyl phosphorodichloridate |
| Molecular Formula | C6H4Cl2NO4P |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OP(=O)(Cl)Cl |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
