| CAS ID | 2581-34-2 |
|---|---|
| IUPAC Name | 3-methyl-4-nitrophenol |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | |
| SMILES | CC1=CC(O)=CC=C1[N+]([O-])=O |
| CAS ID | 2581-34-2 |
|---|---|
| IUPAC Name | 3-methyl-4-nitrophenol |
| Molecular Formula | C7H7NO3 |
| Molecular Weight | |
| SMILES | CC1=CC(O)=CC=C1[N+]([O-])=O |
| 17412 |
Synonym:4-nitro-m-cresol, 4-nitro-3-cresol, 4-nitro-3-methylphenol, 2-nitro-5-hydroxytoluene, 5-hydroxy-2-nitrotoluene, phenol, 3-methyl-4-nitro, 4-nitro-5-methylphenol, m-cresol, 4-nitro, p-nitro-m-cresol, 4-nitro-1-hydroxy-3-methylbenzene
| Color | Yellow |
| Melting Point | 128°C |
| UN Number | 2446 |
| Formula Weight | 153.14 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 4-Nitro-m-cresol |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
