| CAS ID | 10215-25-5 |
|---|---|
| IUPAC Name | 10,10-dioxo-9H-thioxanthene-3,6-diamine |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | |
| SMILES | C1C2=C(C=C(C=C2)N)S(=O)(=O)C3=C1C=CC(=C3)N |
| CAS ID | 10215-25-5 |
|---|---|
| IUPAC Name | 10,10-dioxo-9H-thioxanthene-3,6-diamine |
| Molecular Formula | C13H12N2O2S |
| Molecular Weight | |
| SMILES | C1C2=C(C=C(C=C2)N)S(=O)(=O)C3=C1C=CC(=C3)N |
| 82456 |
Synonym: 9h-thioxanthene-3,6-diamine 10,10-dioxide, 9h-thioxanthene-3,6-diamine, 10,10-dioxide, 3,6-diamino-9h-thioxanthene 10,10-dioxide, 3,6-thioxanthenediamine-10,10-dioxide, 3,7-thiaxanthenediamine-5,5-dioxide, 9h-thioxanthene-3,7-diamine, 5,5-dioxide, 9h-thioxanthene-3,6-diamine,10,10-dioxide, 3,7-diamino-10h-dibenzo b,e thiin-5,5-dione, 3,6-diamino-9h-10??-thioxanthene-10,10-dione, 3,6-diamino-9h-10
| CAS Min % | 96.0 |
| CAS Max % | 100.0 |
| Color | Beige to Green-Yellow |
| Melting Point | 213°C to 215°C |
| Assay Percent Range | 96% min. (HPLC) |
| Infrared Spectrum | Authentic |
| Packaging | Glass bottle |
| Formula Weight | 260.32 |
| Physical Form | Powder |
| Chemical Name or Material | 3, 6-Thioxanthenediamine-10, 10-dioxide, 97% |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
