| CAS ID | 10852546 |
|---|---|
| IUPAC Name | 3, 6-Dimethyldibenzothiophene |
| Molecular Formula | C14H12S |
| Molecular Weight | |
| SMILES | CC1=C2C(C3=CC=C(C)C=C3S2)=CC=C1 |
| CAS ID | 10852546 |
|---|---|
| IUPAC Name | 3, 6-Dimethyldibenzothiophene |
| Molecular Formula | C14H12S |
| Molecular Weight | |
| SMILES | CC1=C2C(C3=CC=C(C)C=C3S2)=CC=C1 |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
