| CAS ID | 2887-72-1 |
|---|---|
| IUPAC Name | 1-(3,5-dibromo-4-hydroxyphenyl)ethan-1-one |
| Molecular Formula | C8H6Br2O2 |
| Molecular Weight | |
| SMILES | CC(=O)C1=CC(Br)=C(O)C(Br)=C1 |
| CAS ID | 2887-72-1 |
|---|---|
| IUPAC Name | 1-(3,5-dibromo-4-hydroxyphenyl)ethan-1-one |
| Molecular Formula | C8H6Br2O2 |
| Molecular Weight | |
| SMILES | CC(=O)C1=CC(Br)=C(O)C(Br)=C1 |
| 76158 |
| Color | Red-White |
| Formula Weight | 293.94 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 3′,5′-Dibromo-4′-hydroxyacetophenone |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
