| CAS ID | 168833-80-5 |
|---|---|
| IUPAC Name | (E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoic acid |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)C=CC(=O)O |
| CAS ID | 168833-80-5 |
|---|---|
| IUPAC Name | (E)-3-[3-(trifluoromethoxy)phenyl]prop-2-enoic acid |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | C1=CC(=CC(=C1)OC(F)(F)F)C=CC(=O)O |
| 735840 |
Synonym: 3-trifluoromethoxy cinnamic acid, 3-3-trifluoromethoxy phenyl acrylic acid, trans-3-trifluoromethoxy cinnamic acid, 2e-3-3-trifluoromethoxy phenyl prop-2-enoic acid, rarechem bk hw 0216, 3-3-trifluoromethoxy-phenyl-acrylic acid, e-3-3-trifluoromethoxy phenyl acrylic acid, e-3-3-trifluoromethoxy phenyl prop-2-enoic acid, 3-3-trifluoromethoxy phenyl prop-2-enoic acid, pubchem4353
| Melting Point | 95°C |
| Color | White-Yellow |
| Formula Weight | 232.16 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 3-(Trifluoromethoxy)cinnamic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
