| CAS ID | 150-19-6 |
|---|---|
| IUPAC Name | [azido(phenoxy)phosphoryl]oxybenzene |
| Molecular Formula | C7H8O2 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)OP(=O)(N=[N+]=[N-])OC2=CC=CC=C2 |
| CAS ID | 150-19-6 |
|---|---|
| IUPAC Name | [azido(phenoxy)phosphoryl]oxybenzene |
| Molecular Formula | C7H8O2 |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)OP(=O)(N=[N+]=[N-])OC2=CC=CC=C2 |
| 9007 |
Synonym: m-methoxyphenol, 3-hydroxyanisole, m-hydroxyanisole, phenol, 3-methoxy, m-guaiacol, resorcinol monomethyl ether, resorcinol methyl ether, 1-hydroxy-3-methoxybenzene, phenol, m-methoxy, 3-methoxy phenol
| Boiling Point | 244°C |
| Color | Yellow |
| UN Number | 2810 |
| Formula Weight | 124.14 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | 3-Methoxyphenol |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
