| CAS ID | 830-96-6 |
|---|---|
| IUPAC Name | 3-(1H-indol-3-yl)propanoic acid |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | |
| SMILES | OC(=O)CCC1=CNC2=CC=CC=C12 |
| CAS ID | 830-96-6 |
|---|---|
| IUPAC Name | 3-(1H-indol-3-yl)propanoic acid |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | |
| SMILES | OC(=O)CCC1=CNC2=CC=CC=C12 |
| 3744 |
Synonym: 3-indolepropionic acid, indole-3-propionic acid, 3-1h-indol-3-yl propanoic acid, 1h-indole-3-propanoic acid, indolepropionic acid, indolylpropionic acid, 3-3-indolyl propionic acid, 3-3-indolyl propanoic acid, ipa auxin, 1h-indole-3-propionic acid
| Color | Undesignated |
| Melting Point | 132°C |
| Formula Weight | 189.21 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 3-Indolepropionic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
