| CAS ID | 121124-97-8 |
|---|---|
| IUPAC Name | (3-formyl-4-methoxyphenyl)boronic acid |
| Molecular Formula | C8H9BO4 |
| Molecular Weight | |
| SMILES | B(C1=CC(=C(C=C1)OC)C=O)(O)O |
| CAS ID | 121124-97-8 |
|---|---|
| IUPAC Name | (3-formyl-4-methoxyphenyl)boronic acid |
| Molecular Formula | C8H9BO4 |
| Molecular Weight | |
| SMILES | B(C1=CC(=C(C=C1)OC)C=O)(O)O |
| 2759225 |
Synonym: 3-formyl-4-methoxybenzeneboronic acid, 3-formyl-4-methoxyphenyl boronic acid, 4-borono-2-formylanisole, 5-borono-2-methoxybenzaldehyde, 5-borono-o-anisaldehyde, 3-formyl-4-methoxylphenylboronic acid, boronic acid, 3-formyl-4-methoxyphenyl, 5-dihydroxyboryl-2-methoxybenzaldehyde, 3-formyl-4-methoxy-phenyl boronic acid
| Sensitivity | Air Sensitive |
| Melting Point | ∽240°C (decomposition) |
| Beilstein | 7423998 |
| Formula Weight | 179.97 |
| Chemical Name or Material | 3-Formyl-4-methoxybenzeneboronic acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
