| CAS ID | 1016-78-0 |
|---|---|
| IUPAC Name | (3-chlorophenyl)-phenylmethanone |
| Molecular Formula | C13H9ClO |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)Cl |
| CAS ID | 1016-78-0 |
|---|---|
| IUPAC Name | (3-chlorophenyl)-phenylmethanone |
| Molecular Formula | C13H9ClO |
| Molecular Weight | |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=CC=C2)Cl |
| 66098 |
Synonym: 3-chlorobenzophenone, 3-chlorophenyl phenyl methanone, benzophenone, 3-chloro, methanone, 3-chlorophenyl phenyl, m-chlorobenzophenone, 3-chlorophenyl-phenylmethanone, methanone, 3-chlorophenyl pheny, 3-chlorophenyl phenyl ketone, 5-chlorobenzophenone, pubchem24414
| Melting Point | 83°C |
| Boiling Point | 332°C |
| Color | White |
| Formula Weight | 216.66 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 3-Chlorobenzophenone |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
