| CAS ID | 38939-88-7 |
|---|---|
| IUPAC Name | 2-chloro-4-methyl-1-nitrobenzene |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])Cl |
| CAS ID | 38939-88-7 |
|---|---|
| IUPAC Name | 2-chloro-4-methyl-1-nitrobenzene |
| Molecular Formula | C7H6ClNO2 |
| Molecular Weight | |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])Cl |
| 123478 |
Synonym: 3-chloro-4-nitrotoluene, 2-chloro-4-methyl-1-nitro-benzene, benzene, 2-chloro-4-methyl-1-nitro, pubchem4534, acmc-1afh8, ksc493s6j
| Color | White-Yellow |
| Boiling Point | 101°C |
| UN Number | 3457 |
| Formula Weight | 171.58 |
| Physical Form | Crystal-Lump at 20°C |
| Chemical Name or Material | 3-Chloro-4-nitrotoluene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
