| CAS ID | 4733-39-5 |
|---|---|
| IUPAC Name | 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline |
| Molecular Formula | C26H20N2 |
| Molecular Weight | |
| SMILES | CC1=CC(C2=CC=CC=C2)=C2C=CC3=C(C=C(C)N=C3C2=N1)C1=CC=CC=C1 |
| CAS ID | 4733-39-5 |
|---|---|
| IUPAC Name | 2,9-dimethyl-4,7-diphenyl-1,10-phenanthroline |
| Molecular Formula | C26H20N2 |
| Molecular Weight | |
| SMILES | CC1=CC(C2=CC=CC=C2)=C2C=CC3=C(C=C(C)N=C3C2=N1)C1=CC=CC=C1 |
| 65149 |
Synonym: bathocuproine, bathocuproin, 1,10-phenanthroline, 2,9-dimethyl-4,7-diphenyl, unii-9thp2v94fx, 9thp2v94fx, 2,9-dimethyl-4,7-diphenylpyridino 3,2-h quinoline, pubchem19657, bathocuproin 1g, bidd:gt0563
| Color | Undesignated |
| Melting Point | 283°C |
| Formula Weight | 360.46 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Bathocuproine (purified by sublimation) |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
