| CAS ID | 3215-64-3 |
|---|---|
| IUPAC Name | 2-(2,6-dichlorophenyl)acetonitrile |
| Molecular Formula | C8H5Cl2N |
| Molecular Weight | |
| SMILES | C1=CC(=C(C(=C1)Cl)CC#N)Cl |
| CAS ID | 3215-64-3 |
|---|---|
| IUPAC Name | 2-(2,6-dichlorophenyl)acetonitrile |
| Molecular Formula | C8H5Cl2N |
| Molecular Weight | |
| SMILES | C1=CC(=C(C(=C1)Cl)CC#N)Cl |
| 76678 |
Synonym: 2,6-dichlorophenylacetonitrile, 2,6-dichlorobenzyl cyanide, 2-2,6-dichlorophenyl acetonitrile, 2,6-dichlorophenyl acetonitrile, 2,6-dichlorobenzeneacetonitrile, benzeneacetonitrile, 2,6-dichloro, acetonitrile, 2,6-dichlorophenyl, 2,6-dichloro-phenyl-acetonitrile, 2-2,6-dichlorophenyl ethanenitrile
| Color | White-Yellow |
| Melting Point | 76°C |
| UN Number | 3439 |
| Formula Weight | 186.04 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2,6-Dichlorobenzyl Cyanide |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
