| CAS ID | 38496-18-3 |
|---|---|
| IUPAC Name | 2,6-dichloropyridine-3-carboxylic acid |
| Molecular Formula | C6H3Cl2NO2 |
| Molecular Weight | |
| SMILES | C1=CC(=NC(=C1C(=O)O)Cl)Cl |
| CAS ID | 38496-18-3 |
|---|---|
| IUPAC Name | 2,6-dichloropyridine-3-carboxylic acid |
| Molecular Formula | C6H3Cl2NO2 |
| Molecular Weight | |
| SMILES | C1=CC(=NC(=C1C(=O)O)Cl)Cl |
| 854047 |
Synonym:2,6-dichloronicotinic acid, 2,6-dichloro-nicotinic acid, 2,6-dichloro-3-pyridinecarboxylic acid, dichloronicotinic acid, 2,6-dichloronicotininc acid, 3-pyridinecarboxylic acid, 2,6-dichloro, 2,6-dichloronicotinincacid, pubchem1225, 2,6-dichlornicotinsaure, acmc-209j0g
| Color | White-Yellow |
| Melting Point | 148°C |
| Formula Weight | 192.00 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2,6-Dichloronicotinic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
