| CAS ID | 955-83-9 |
|---|---|
| Molecular Formula | C16H12O |
| Molecular Weight | |
| SMILES | C1(C2=CC=CC=C2)=CC=C(C3=CC=CC=C3)O1 |
| CAS ID | 955-83-9 |
|---|---|
| Molecular Formula | C16H12O |
| Molecular Weight | |
| SMILES | C1(C2=CC=CC=C2)=CC=C(C3=CC=CC=C3)O1 |
| 70387 |
| Color | White-Yellow |
| Melting Point | 90°C |
| Boiling Point | 345°C |
| Formula Weight | 220.27 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2,5-Diphenylfuran |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
