| CAS ID | 8134383 |
|---|---|
| IUPAC Name | 2, 5-Diaminohydroquinone dihydrochloride |
| Molecular Formula | C6H10Cl2N2O2 |
| Molecular Weight | |
| SMILES | OC1=CC(N)=C(O)C=C1N.[H]Cl.[H]Cl |
| CAS ID | 8134383 |
|---|---|
| IUPAC Name | 2, 5-Diaminohydroquinone dihydrochloride |
| Molecular Formula | C6H10Cl2N2O2 |
| Molecular Weight | |
| SMILES | OC1=CC(N)=C(O)C=C1N.[H]Cl.[H]Cl |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
