| CAS ID | 1122-41-4 |
|---|---|
| IUPAC Name | 2, 4-Dichlorobenzenethiol |
| Molecular Formula | C6H4Cl2S |
| Molecular Weight | |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)N)[N+](=O)[O-] |
| CAS ID | 1122-41-4 |
|---|---|
| IUPAC Name | 2, 4-Dichlorobenzenethiol |
| Molecular Formula | C6H4Cl2S |
| Molecular Weight | |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)N)[N+](=O)[O-] |
| 70730 |
Synonym:2,4-dichlorothiophenol, 2,4-dichlorobenzene-1-thiol, benzenethiol, 2,4-dichloro, 2,4-dichloro thiophenol, pubchem6798, 2,4 dichlorothiophenol, acmc-1buvb, 2,4-dichlorothio-phenol, 2,4-dichloro-benzenethiol, #
| Color | Yellow |
| Boiling Point | 115°C |
| Formula Weight | 179.06 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | 2,4-Dichlorobenzenethiol |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
