| CAS ID | 13108-52-6 |
|---|---|
| IUPAC Name | 2, 3, 5, 6-tetrochloro-4-(methlysulfonyl) Pyridine |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | CS(=O)(=O)C1=C(C(=NC(=C1Cl)Cl)Cl)Cl |
| CAS ID | 13108-52-6 |
|---|---|
| IUPAC Name | 2, 3, 5, 6-tetrochloro-4-(methlysulfonyl) Pyridine |
| Molecular Formula | N/A |
| Molecular Weight | |
| SMILES | CS(=O)(=O)C1=C(C(=NC(=C1Cl)Cl)Cl)Cl |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
