| CAS ID | 1975-50-4 |
|---|---|
| IUPAC Name | 2-Methyl-3-nitrobenzoic acid |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | |
| SMILES | CC1=C(C=CC=C1[N+](=O)[O-])C(=O)O |
| CAS ID | 1975-50-4 |
|---|---|
| IUPAC Name | 2-Methyl-3-nitrobenzoic acid |
| Molecular Formula | C8H7NO4 |
| Molecular Weight | |
| SMILES | CC1=C(C=CC=C1[N+](=O)[O-])C(=O)O |
| 16096 |
Synonym: 2-methyl-3-nitrobenzoic acid, 3-nitro-o-toluic acid, benzoic acid, 2-methyl-3-nitro, 2-methyl-3-nitrobenzoicacid, unii-0si17d349b, 3-nitro-2-methyl benzoic acid, 3-nitro-2-methylbenzoic acid, 2-methyl-3-nitro-benzoic acid, benzoic acid,2-methyl-3-nitro, pubchem4522
| Color | Undesignated |
| Melting Point | 184°C |
| Formula Weight | 181.15 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-Methyl-3-nitrobenzoic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
