| CAS ID | 184970-25-0 |
|---|---|
| IUPAC Name | 1-(bromomethyl)-2-fluoro-3-(trifluoromethyl)benzene |
| Molecular Formula | C8H5BrF4 |
| Molecular Weight | |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)CBr |
| CAS ID | 184970-25-0 |
|---|---|
| IUPAC Name | 1-(bromomethyl)-2-fluoro-3-(trifluoromethyl)benzene |
| Molecular Formula | C8H5BrF4 |
| Molecular Weight | |
| SMILES | C1=CC(=C(C(=C1)C(F)(F)F)F)CBr |
| 2737569 |
Synonym: 2-fluoro-3-trifluoromethyl benzyl bromide, 1-bromomethyl-2-fluoro-3-trifluoromethyl benzene, 2-fluoro-3-trifluoromethyl benzylbromide, a-bromo-2-fluoro-3-trifluoromethyl toluene, 3-bromomethyl-2-fluoro-1-trifluoromethyl benzene, alpha-bromo-2-fluoro-3-trifluoromethyl toluene, 1-bromomethyl-2-fluoro-3-trifluoromethyl-benzene, pubchem4930, acmc-1c3hd, 2-fluoro-3-trifluoromethylbenzyl bromide
| Sensitivity | Moisture sensitive |
| Melting Point | 47°C to 49°C |
| UN Number | UN1759 |
| Formula Weight | 257.03 |
| Chemical Name or Material | 2-Fluoro-3-(trifluoromethyl)benzyl bromide |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
