| CAS ID | 12764-43-1 |
|---|---|
| IUPAC Name | 2-Ethyl-6-methyl-3-hydroxypyridine succinate |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | |
| SMILES | OC1=CC=C(C)N=C1CC.O=C(O)CCC(O)=O |
| CAS ID | 12764-43-1 |
|---|---|
| IUPAC Name | 2-Ethyl-6-methyl-3-hydroxypyridine succinate |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | |
| SMILES | OC1=CC=C(C)N=C1CC.O=C(O)CCC(O)=O |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
The 2-Ethyl-6-methyl-3-hydroxypyridine succinate melting point typically ranges between 195–198°C, depending on purity and conditions. It's a stable compound under normal storage.
2-Ethyl-6-methyl-3-hydroxypyridine succinate solubility is high in water and ethanol, making it suitable for both aqueous and alcohol-based formulations.
The 2-Ethyl-6-methyl-3-hydroxypyridine succinate molecular mass is approximately 241.28 g/mol. This value helps in accurate dosing and formulation in research settings.
Typical 2-Ethyl-6-methyl-3-hydroxypyridine succinate packaging includes airtight, light-resistant containers, designed to maintain stability and prevent moisture absorption during storage and transit.
2-Ethyl-6-methyl-3-hydroxypyridine succinate solubility is high in water and ethanol, making it suitable for both aqueous and alcohol-based formulations.
