| CAS ID | 14375-45-2 |
|---|---|
| IUPAC Name | (2Z,4E)-5-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
| Molecular Formula | C15H20O4 |
| Molecular Weight | |
| SMILES | CC1=CC(=O)CC(C1(C=CC(=CC(=O)O)C)O)(C)C |
| CAS ID | 14375-45-2 |
|---|---|
| IUPAC Name | (2Z,4E)-5-(1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl)-3-methylpenta-2,4-dienoic acid |
| Molecular Formula | C15H20O4 |
| Molecular Weight | |
| SMILES | CC1=CC(=O)CC(C1(C=CC(=CC(=O)O)C)O)(C)C |
| 5375199 |
Synonyms: abscisic acid, +/–abscisic acid, acide abscissique, 2z,4e-5-1-hydroxy-2,6,6-trimethyl-4-oxocyclohex-2-en-1-yl-3-methylpenta-2,4-dienoic acid, abscisinsaeure, abszisinsaeure, acido abscisico, +-abscisic acid, 2-cis-abscisic acid, rs-abscisic acid
| Color | Undesignated |
| Melting Point | 186°C |
| Formula Weight | 264.32 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Abscisic Acid (Synthetic) |
An organic molecule used as a building block in organic synthesis is 2-cis,4-trans-abscisic acid (synthetic). Additionally, during asymmetric synthesis, it serves as a chiral auxiliary. By acting as chiral templates that promote the synthesis of particular products, ABA derivatives can regulate the stereochemistry of processes.
2-cis,4-trans-Abscisic Acid (Synthetic) is widely used for industrial polyester and polyurethane production. Its relatively lengthy hydrocarbon chain can help polyesters become harder and more flexible. It is employed as a chain extender in polyurethanes, and the modified polyurethane produced has a low glass transition temperature and a high resistance to hydrolysis.
2-cis,4-trans-Abscisic Acid (Synthetic) is a versatile product with many benefits. It is an effective monomer in synthesizing some polymers, such as polyesters and polyurethanes.
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
