| CAS ID | 328-87-0 |
|---|---|
| IUPAC Name | 2-Chloro-5(trifluoromethyl)benzonitrile |
| Molecular Formula | C8H3ClF3N |
| Molecular Weight | |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C#N)Cl |
| CAS ID | 328-87-0 |
|---|---|
| IUPAC Name | 2-Chloro-5(trifluoromethyl)benzonitrile |
| Molecular Formula | C8H3ClF3N |
| Molecular Weight | |
| SMILES | C1=CC(=C(C=C1C(F)(F)F)C#N)Cl |
| 67604 |
Synonym:2-chloro-5-trifluoromethyl benzonitrile, benzonitrile, 2-chloro-5-trifluoromethyl, 4-chloro-3-cyanobenzotrifluoride, 4-chloro-3-cyanobenzo trifluoride, 4-chloro-3-cyanbenzotrifluoride, 2-chloro-5-trifluoromethyl benzenecarbonitrile, ncr bg exfff, pubchem4749, acmc-1cq7c, ksc494q7d
| Boiling Point | 212°C |
| Color | Undesignated |
| Melting Point | 39°C |
| UN Number | 3439 |
| Formula Weight | 205.56 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-Chloro-5-(trifluoromethyl)benzonitrile |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
