| CAS ID | 102940-86-3 |
|---|---|
| IUPAC Name | 2-Chloro-3-fluorobenzoic Acid |
| Molecular Formula | C7H4ClFO2 |
| Molecular Weight | |
| SMILES | C1=CC(=C(C(=C1)F)Cl)C(=O)O |
| CAS ID | 102940-86-3 |
|---|---|
| IUPAC Name | 2-Chloro-3-fluorobenzoic Acid |
| Molecular Formula | C7H4ClFO2 |
| Molecular Weight | |
| SMILES | C1=CC(=C(C(=C1)F)Cl)C(=O)O |
| 302620 |
Synonym: 2-chloro-3-fluorobenzoicacid, 2-chloro-3-fluoro-benzoic acid, benzoic acid, 2-chloro-3-fluoro, pubchem1369, ksc493s0f, buttpark 19\01-64, 2-chloranyl-3-fluoranyl-benzoic acid
| Color | White-Yellow |
| Melting Point | 171°C |
| Formula Weight | 174.56 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2-Chloro-3-fluorobenzoic Acid |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
