| CAS ID | 35273478 |
|---|---|
| IUPAC Name | methyl 2-(bromomethyl)-3-nitrobenzoate |
| Molecular Formula | C9H8BrNO4 |
| Molecular Weight | |
| SMILES | COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])CBr |
| CAS ID | 35273478 |
|---|---|
| IUPAC Name | methyl 2-(bromomethyl)-3-nitrobenzoate |
| Molecular Formula | C9H8BrNO4 |
| Molecular Weight | |
| SMILES | COC(=O)C1=C(C(=CC=C1)[N+](=O)[O-])CBr |
| 1487795 |
| Color | Yellow |
| Melting Point | 73°C |
| UN Number | 3261 |
| Formula Weight | 274.07 |
| Physical Form | Crystal-Powder at 20°C |
| Percent Purity | ≥98.0% (GC) |
| Chemical Name or Material | Methyl 2-(Bromomethyl)-3-nitrobenzoate |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
