| CAS ID | 21282-97-3 |
|---|---|
| IUPAC Name | 2-[(2-methylprop-2-enoyl)oxy]ethyl 3-oxobutanoate |
| Molecular Formula | C10H14O5 |
| Molecular Weight | |
| SMILES | CC(=O)CC(=O)OCCOC(=O)C(C)=C |
| CAS ID | 21282-97-3 |
|---|---|
| IUPAC Name | 2-[(2-methylprop-2-enoyl)oxy]ethyl 3-oxobutanoate |
| Molecular Formula | C10H14O5 |
| Molecular Weight | |
| SMILES | CC(=O)CC(=O)OCCOC(=O)C(C)=C |
| 88855 |
Synonym : aaem, 2-methacryloyloxy ethyl 3-oxobutanoate, 2-methacryloyloxy ethyl acetoacetate, acetoacetoxyethyl methacrylate, unii-6l3ew3hzf2, 6l3ew3hzf2, 2-acetoacetyloxy ethyl methacrylate, hema acetoacetate, 2-2-methylacryloyl oxy ethyl 3-oxobutanoate
| Boiling Point | 100°C |
| Color | Yellow |
| Formula Weight | 214.22 |
| Physical Form | Clear Liquid at 20°C |
| Chemical Name or Material | Ethylene Glycol Monoacetoacetate Monomethacrylate (stabilized with BHT) |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
