| CAS ID | 83-31-8 |
|---|---|
| IUPAC Name | 1, 8-Naphthosultone |
| Molecular Formula | C10H6O3S |
| Molecular Weight | |
| SMILES | C1=CC2=C3C(=C1)OS(=O)(=O)C3=CC=C2 |
| CAS ID | 83-31-8 |
|---|---|
| IUPAC Name | 1, 8-Naphthosultone |
| Molecular Formula | C10H6O3S |
| Molecular Weight | |
| SMILES | C1=CC2=C3C(=C1)OS(=O)(=O)C3=CC=C2 |
| 65744 |
Synonym: 8-Hydroxynaphthalene-1-sulfonic Acid Sultone, 1,8-Naphthalenesultone, 1-Naphthol-8-sulfonic Acid Sultone
| Color | Yellow |
| Melting Point | 158°C |
| Formula Weight | 206.22 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1,8-Naphthosultone |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
