| CAS ID | 82-43-9 |
|---|---|
| IUPAC Name | 1,8-dichloroanthracene-9,10-dione |
| Molecular Formula | C14H6Cl2O2 |
| Molecular Weight | |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=O)C3=C(C2=O)C=CC=C3Cl |
| CAS ID | 82-43-9 |
|---|---|
| IUPAC Name | 1,8-dichloroanthracene-9,10-dione |
| Molecular Formula | C14H6Cl2O2 |
| Molecular Weight | |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=O)C3=C(C2=O)C=CC=C3Cl |
| 6708 |
Synonym:1,8-dichloroanthraquinone, 9,10-anthracenedione, 1,8-dichloro, 1,8-dichloranthrachinon, 1,8-dichloro-9,10-anthraquinone, anthraquinone, 1,8-dichloro, 1,8-dichloranthrachinon czech, acmc-1bmbx, 9, 1,8-dichloro, anthraquinone,8-dichloro
| Color | White-Yellow |
| Melting Point | 202°C |
| Formula Weight | 277.10 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1,8-Dichloroanthraquinone |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
