| CAS ID | 115-27-5 |
|---|---|
| IUPAC Name | 1, 3-dicarboxylic acid anhydride, 4, 5, 6, 7, 7-Hexachloro-5-norbornene-2 |
| Molecular Formula | C9H2Cl6O3 |
| Molecular Weight | |
| SMILES | C12C(C(=O)OC1=O)C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl |
| CAS ID | 115-27-5 |
|---|---|
| IUPAC Name | 1, 3-dicarboxylic acid anhydride, 4, 5, 6, 7, 7-Hexachloro-5-norbornene-2 |
| Molecular Formula | C9H2Cl6O3 |
| Molecular Weight | |
| SMILES | C12C(C(=O)OC1=O)C3(C(=C(C2(C3(Cl)Cl)Cl)Cl)Cl)Cl |
| 18529 |
Synonym: chlorendic anhydride, het anhydride, chloran 542, 4,7-methanoisobenzofuran-1,3-dione, 4,5,6,7,8,8-hexachloro-3a,4,7,7a-tetrahydro, 1,4,5,6,7,7-hexachloro-5-norbornene-2,3-dicarboxylic anhydride, chlorendic anhydride van, 4,5,6,7,8,8-hexachloro-3a,4,7,7a-tetrahydro-4,7-methanoisobenzofuran-1,3-dione, hexachloroendomethylene tetrahydrophthalic anhydride, hexachloro-5-norbornene-2,3-dicarboxylic anhydride, 5-norbornene-2,3-dicarboxylic anhydride, 1,4,5,6,7,7-hexachloro
| Melting Point | 238°C |
| Color | White |
| Formula Weight | 370.81 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | Het Anhydride |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
