| CAS ID | 245679-18-9 |
|---|---|
| IUPAC Name | 1, 3-Bis(2, 4, 5-dihydroimidazolium tetrafluoroborate, 6-trimethylphenyl)-4 |
| Molecular Formula | C21H27BF4N2 |
| Molecular Weight | |
| SMILES | [B-](F)(F)(F)F.CC1=CC(=C(C(=C1)C)N2CC[N+](=C2)C3=C(C=C(C=C3C)C)C)C |
| CAS ID | 245679-18-9 |
|---|---|
| IUPAC Name | 1, 3-Bis(2, 4, 5-dihydroimidazolium tetrafluoroborate, 6-trimethylphenyl)-4 |
| Molecular Formula | C21H27BF4N2 |
| Molecular Weight | |
| SMILES | [B-](F)(F)(F)F.CC1=CC(=C(C(=C1)C)N2CC[N+](=C2)C3=C(C=C(C=C3C)C)C)C |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
