| CAS ID | 1732-13-4 |
|---|---|
| IUPAC Name | 1,2,3,6,7,8-hexahydropyrene |
| Molecular Formula | C16H16 |
| Molecular Weight | |
| SMILES | C1CC2=C3C(=CC=C4C3=C(CCC4)C=C2)C1 |
| CAS ID | 1732-13-4 |
|---|---|
| IUPAC Name | 1,2,3,6,7,8-hexahydropyrene |
| Molecular Formula | C16H16 |
| Molecular Weight | |
| SMILES | C1CC2=C3C(=CC=C4C3=C(CCC4)C=C2)C1 |
| 74417 |
| Color | White |
| Melting Point | 134°C |
| Formula Weight | 208.30 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1,2,3,6,7,8-Hexahydropyrene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
