| CAS ID | 1246214-90-3 |
|---|---|
| IUPAC Name | 1, 2 cyclohexanediol, 2R, 3-amino(1S, 3S) |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | |
| SMILES | O[C@@H]1[C@H](O)[C@@H](N)CCC1 |
| CAS ID | 1246214-90-3 |
|---|---|
| IUPAC Name | 1, 2 cyclohexanediol, 2R, 3-amino(1S, 3S) |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | |
| SMILES | O[C@@H]1[C@H](O)[C@@H](N)CCC1 |
Our team of scientists has experience in all areas of research including Life Science, Material Science, Chemical Synthesis, Chromatography, Analytical and many others.
