| CAS ID | 781-35-1 |
|---|---|
| IUPAC Name | 1, 1-Diphenylacetone |
| Molecular Formula | C15H14O |
| Molecular Weight | |
| SMILES | O=C(C)C(C1=CC=CC=C1)C2=CC=CC=C2 |
| CAS ID | 781-35-1 |
|---|---|
| IUPAC Name | 1, 1-Diphenylacetone |
| Molecular Formula | C15H14O |
| Molecular Weight | |
| SMILES | O=C(C)C(C1=CC=CC=C1)C2=CC=CC=C2 |
| 69907 |
Synonym: 1,1-diphenylacetone, 1,1-diphenyl-2-propanone, 2-propanone, 1,1-diphenyl, 1,1-diphenyl acetone, methyl diphenylmethyl ketone, ketone, diphenylmethyl methyl, benzhydryl methyl ketone, diphenylacetone, 3,3-diphenyl acetone, 2-propanone, diphenyl
| Color | White-Yellow |
| Melting Point | 62°C |
| Boiling Point | 135°C |
| Formula Weight | 210.28 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 1,1-Diphenylacetone |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
