| CAS ID | 101597-25-5 |
|---|---|
| IUPAC Name | 1, 1-Bis(4-methoxyphenyl)prop-2-yn-1-ol |
| Molecular Formula | C17H16O3 |
| Molecular Weight | |
| SMILES | C#CC(C1=CC=C(OC)C=C1)(C2=CC=C(OC)C=C2)O |
| CAS ID | 101597-25-5 |
|---|---|
| IUPAC Name | 1, 1-Bis(4-methoxyphenyl)prop-2-yn-1-ol |
| Molecular Formula | C17H16O3 |
| Molecular Weight | |
| SMILES | C#CC(C1=CC=C(OC)C=C1)(C2=CC=C(OC)C=C2)O |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
