| CAS ID | 350-46-9 |
|---|---|
| IUPAC Name | 1-Fluoro-4-nitrobenzene |
| Molecular Formula | C6H4FNO2 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])F |
| CAS ID | 350-46-9 |
|---|---|
| IUPAC Name | 1-Fluoro-4-nitrobenzene |
| Molecular Formula | C6H4FNO2 |
| Molecular Weight | |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])F |
| 9590 |
Synonym: 4-fluoronitrobenzene, p-fluoronitrobenzene, p-nitrofluorobenzene, benzene, 1-fluoro-4-nitro, 4-nitrofluorobenzene, 1-nitro-4-fluorobenzene, 4-fluoro-1-nitrobenzene, 1-fluoro-4-nitro-benzene, unii-a2m2fh7xhh, p-fluoro nitrobenzene
| Boiling Point | 207°C |
| Color | Undesignated |
| UN Number | 2811 |
| Formula Weight | 141.10 |
| Physical Form | Crystal-Lump at 20°C |
| Chemical Name or Material | 4-Fluoronitrobenzene |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
