| CAS ID | 88-76-6 |
|---|---|
| IUPAC Name | 1-(2-Chloro-5-Sulfophenyl)-3-Methyl-5-Pyrazolone |
| Molecular Formula | C10H9ClN2O4S |
| Molecular Weight | |
| SMILES | O=C1C=C(C)NN1C2=CC(S(=O)(O)=O)=CC=C2Cl |
| CAS ID | 88-76-6 |
|---|---|
| IUPAC Name | 1-(2-Chloro-5-Sulfophenyl)-3-Methyl-5-Pyrazolone |
| Molecular Formula | C10H9ClN2O4S |
| Molecular Weight | |
| SMILES | O=C1C=C(C)NN1C2=CC(S(=O)(O)=O)=CC=C2Cl |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
No FAQs available
