| CAS ID | 3380-34-5 |
|---|---|
| IUPAC Name | 5-chloro-2-(2,4-dichlorophenoxy)phenol |
| Molecular Formula | C12H7Cl3O2 |
| Molecular Weight | |
| SMILES | C1=CC(=C(C=C1Cl)O)OC2=C(C=C(C=C2)Cl)Cl |
| CAS ID | 3380-34-5 |
|---|---|
| IUPAC Name | 5-chloro-2-(2,4-dichlorophenoxy)phenol |
| Molecular Formula | C12H7Cl3O2 |
| Molecular Weight | |
| SMILES | C1=CC(=C(C=C1Cl)O)OC2=C(C=C(C=C2)Cl)Cl |
| 5564 |
Synonym: triclosan, 5-chloro-2-2,4-dichlorophenoxy phenol, irgasan, 2,4,4′-trichloro-2′-hydroxydiphenyl ether, cloxifenolum, triclosanum, irgasan dp300, stri-dex face wash, aquasept, sapoderm
| Color | White |
| Melting Point | 57°C |
| Boiling Point | 290°C |
| UN Number | 3077 |
| Formula Weight | 289.54 |
| Physical Form | Crystal-Powder at 20°C |
| Chemical Name or Material | 2,4,4′-Trichloro-2′-hydroxydiphenyl Ether |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
FAQs
