| CAS ID | 207737-97-1 |
|---|---|
| IUPAC Name | Sodium Taurodeoxycholate |
| Molecular Formula | C26H44NNaO6S |
| Molecular Weight | |
| SMILES | O=S([O-])(CCNC(CC[C@@H](C)[C@H]1CC[C@@]2([H])[C@]3([H])CCC4C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)=O)=O.[Na+] |
| CAS ID | 207737-97-1 |
|---|---|
| IUPAC Name | Sodium Taurodeoxycholate |
| Molecular Formula | C26H44NNaO6S |
| Molecular Weight | |
| SMILES | O=S([O-])(CCNC(CC[C@@H](C)[C@H]1CC[C@@]2([H])[C@]3([H])CCC4C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)=O)=O.[Na+] |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
