| CAS ID | 491-72-5 |
|---|---|
| IUPAC Name | Olivetolic Acid |
| Molecular Formula | C12H16O4 |
| Molecular Weight | |
| SMILES | CCCCCC1=CC(=CC(=C1C(=O)O)O)O |
| CAS ID | 491-72-5 |
|---|---|
| IUPAC Name | Olivetolic Acid |
| Molecular Formula | C12H16O4 |
| Molecular Weight | |
| SMILES | CCCCCC1=CC(=CC(=C1C(=O)O)O)O |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
The boiling point of olivetolic acid is 162 to 164 °C.
The melting point of olivetolic acid is 148-149°C (298-298°F).
The molecular weight of olivetolic acid is 224.256 g/mol.
The olivetolic acid chemical formula is C12H16O3.
Olivetolic acid has a phenolic structure with a carboxyl (-COOH) functional group and a pentyl side chain attached to a benzene ring. Its IUPAC name is 2,4-Dihydroxy-6-pentylbenzoic acid.
