| CAS ID | 5438-68-6 |
|---|---|
| IUPAC Name | O-Acetyl mandelic acid |
| Molecular Formula | C10H10O4 |
| Molecular Weight | |
| SMILES | OC(C1=CC=CC=C1C(C)=O)C(O)=O |
| CAS ID | 5438-68-6 |
|---|---|
| IUPAC Name | O-Acetyl mandelic acid |
| Molecular Formula | C10H10O4 |
| Molecular Weight | |
| SMILES | OC(C1=CC=CC=C1C(C)=O)C(O)=O |
Our scientists have experience in all research areas, including life science, material science, chemical custom synthesis, chromatography, analytical science, and many others.
No FAQs available
